CAS 326901-31-9 is the registry number for N-(6-Methylpyridin-2-yl)-2-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(6-methyl-2-pyridinyl)-2-nitrobenzamide (CAS 326901-31-9) is a chemical compound with the molecular formula C13H11N3O3 and a molecular weight of 257.24 g/mol. IUPAC name: N-(6-methyl-2-pyridinyl)-2-nitrobenzamide. InChIKey: QLRHTGRGJNNLPD-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O3 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | N-(6-methyl-2-pyridinyl)-2-nitrobenzamide |
| InChIKey | QLRHTGRGJNNLPD-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NC(=O)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)