CAS 1630763-67-5 is the registry number for 5-Amino-2-(cyclohexylcarbonyl)isoxazol-3(2h)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-amino-2-(cyclohexanecarbonyl)-1,2-oxazol-3-one (CAS 1630763-67-5) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: 5-amino-2-(cyclohexanecarbonyl)-1,2-oxazol-3-one. InChIKey: CZZFADZPKFPKIM-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 5-amino-2-(cyclohexanecarbonyl)-1,2-oxazol-3-one |
| InChIKey | CZZFADZPKFPKIM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)N2C(=O)C=C(O2)N |
Computed by PubChem (NCBI)