Products 163077-89-2
CAS 163077-89-2 appears in our catalog under these names: Ethyl 3–fluoro–2–nitrobenzoate, 3-Fluoro-2-nitrobenzoic acid ethyl ester, Ethyl 3-fluoro-2-nitrobenzoate, 98%, 98%, 3-Fluoro-2-nitrobenzoic acid ethyl ester, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g.
Ethyl 3-fluoro-2-nitrobenzoate (CAS 163077-89-2) is a chemical compound with the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. IUPAC name: ethyl 3-fluoro-2-nitrobenzoate. InChIKey: GISOWGLYGNGJHV-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO4 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | ethyl 3-fluoro-2-nitrobenzoate |
| InChIKey | GISOWGLYGNGJHV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)