CAS 1630807-26-9 is the registry number for Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate (CAS 1630807-26-9) is a chemical compound with the molecular formula C12H17BO5 and a molecular weight of 252.07 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate. InChIKey: VKLPVFKOLDUFLM-UHFFFAOYSA-N.
| Molecular formula | C12H17BO5 |
|---|---|
| Molecular weight | 252.07 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate |
| InChIKey | VKLPVFKOLDUFLM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=COC(=C2)C(=O)OC |
Computed by PubChem (NCBI)