CAS 2363164-32-1 appears in our catalog under these names: 4-(Methoxycarbonyl)furan-3-boronic acid, pinacol ester, 96%, Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carboxylate (CAS 2363164-32-1) is a chemical compound with the molecular formula C12H17BO5 and a molecular weight of 252.07 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carboxylate. InChIKey: HHIPQLAFIIJQNZ-UHFFFAOYSA-N.
| Molecular formula | C12H17BO5 |
|---|---|
| Molecular weight | 252.07 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carboxylate |
| InChIKey | HHIPQLAFIIJQNZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=COC=C2C(=O)OC |
Computed by PubChem (NCBI)