CAS 676501-87-4 appears in our catalog under these names: 5-(Methoxycarbonyl)furan-2-boronic acid pinacol ester, 98%, (5-(Methoxycarbonyl)furan-2-yl)boronic acid pinacol ester, 95-<97%, (5-(Methoxycarbonyl)furan-2-yl)boronic acid pinacol ester, ≥97-<99%, Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate, 97%, 5-(Methoxycarbonyl)furan-2-boronic acid pinacol ester. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 2,5g, 5g, 10g, 25g, 50mg, 0,5g.
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate (CAS 676501-87-4) is a chemical compound with the molecular formula C12H17BO5 and a molecular weight of 252.07 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate. InChIKey: HHXRIHYFWBIMFT-UHFFFAOYSA-N.
| Molecular formula | C12H17BO5 |
|---|---|
| Molecular weight | 252.07 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-carboxylate |
| InChIKey | HHXRIHYFWBIMFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(O2)C(=O)OC |
Computed by PubChem (NCBI)