Products 871217-46-8
CAS 871217-46-8 is the registry number for 4-Amino-1-methyl-2-oxo-1-azaspiro[4.4]non-3-ene-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
4-amino-1-methyl-2-oxo-1-azaspiro[4.4]non-3-ene-3-carboxamide (CAS 871217-46-8) is a chemical compound with the molecular formula C10H15N3O2 and a molecular weight of 209.24 g/mol. IUPAC name: 4-amino-1-methyl-2-oxo-1-azaspiro[4.4]non-3-ene-3-carboxamide. InChIKey: QKWJUEIKCYGIOW-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-amino-1-methyl-2-oxo-1-azaspiro[4.4]non-3-ene-3-carboxamide |
| InChIKey | QKWJUEIKCYGIOW-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C12CCCC2)N)C(=O)N |
Computed by PubChem (NCBI)