Products 163263-91-0
CAS 163263-91-0 appears in our catalog under these names: 2，4-Dichloro-6-(4-methoxyphenyl)pyrimidine, 97%, 97%, 2,4-Dichloro-6-(4-methoxyphenyl)pyrimidine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
2,4-dichloro-6-(4-methoxyphenyl)pyrimidine (CAS 163263-91-0) is a chemical compound with the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. IUPAC name: 2,4-dichloro-6-(4-methoxyphenyl)pyrimidine. InChIKey: QYHGNJWTEXUEGF-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 2,4-dichloro-6-(4-methoxyphenyl)pyrimidine |
| InChIKey | QYHGNJWTEXUEGF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)