Products 1633017-90-9
CAS 1633017-90-9 is the registry number for 4-(1,10-PHENANTHROLIN-5-YL)BENZOIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-(1,10-phenanthrolin-5-yl)benzoic acid (CAS 1633017-90-9) is a chemical compound with the molecular formula C19H12N2O2 and a molecular weight of 300.3 g/mol. IUPAC name: 4-(1,10-phenanthrolin-5-yl)benzoic acid. InChIKey: WDRBWKSTPGMTHS-UHFFFAOYSA-N.
| Molecular formula | C19H12N2O2 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 4-(1,10-phenanthrolin-5-yl)benzoic acid |
| InChIKey | WDRBWKSTPGMTHS-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)