CAS 1643120-60-8 appears in our catalog under these names: YZ129, 99%, YZ129, YZ129, 99.85%, 99.85%, YZ129, 99.85%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 2mg, 10mg, 25mg, 50mg, 5mg, 100 mg, 50 mg.
4-(isoquinolin-6-ylamino)naphthalene-1,2-dione (CAS 1643120-60-8) is a chemical compound with the molecular formula C19H12N2O2 and a molecular weight of 300.3 g/mol. IUPAC name: 4-(isoquinolin-6-ylamino)naphthalene-1,2-dione. InChIKey: NYDMVPHEEBVAHT-UHFFFAOYSA-N.
| Molecular formula | C19H12N2O2 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 4-(isoquinolin-6-ylamino)naphthalene-1,2-dione |
| InChIKey | NYDMVPHEEBVAHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)C2=O)NC3=CC4=C(C=C3)C=NC=C4 |
Computed by PubChem (NCBI)