Products 549548-25-6
CAS 549548-25-6 is the registry number for 5,11-Dihydro-8-hydroxyindolo[3,2-b]carbazole-6-carboxaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-5,11-dihydroindolo[3,2-b]carbazole-12-carbaldehyde (CAS 549548-25-6) is a chemical compound with the molecular formula C19H12N2O2 and a molecular weight of 300.3 g/mol. IUPAC name: 2-hydroxy-5,11-dihydroindolo[3,2-b]carbazole-12-carbaldehyde. InChIKey: UBSNONGPZJJCAD-UHFFFAOYSA-N.
| Molecular formula | C19H12N2O2 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 2-hydroxy-5,11-dihydroindolo[3,2-b]carbazole-12-carbaldehyde |
| InChIKey | UBSNONGPZJJCAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC4=C(C5=C(N4)C=CC(=C5)O)C(=C3N2)C=O |
Computed by PubChem (NCBI)