CAS 163400-20-2 appears in our catalog under these names: 1-Bromopropane-1,1,3,3,3-d5, 98 atom % D, min 98% Chemical Purity, 1-Bromopropane-1,1,3,3,3-d5. Offered by: CDN, Biosynth. Available pack sizes: 0,5g, 0,25g, 250mg, 100mg.
1-bromo-1,1,3,3,3-pentadeuteriopropane (CAS 163400-20-2) is a chemical compound with the molecular formula C3H7Br and a molecular weight of 128.02 g/mol. IUPAC name: 1-bromo-1,1,3,3,3-pentadeuteriopropane. InChIKey: CYNYIHKIEHGYOZ-WNWXXORZSA-N.
| Molecular formula | C3H7Br |
|---|---|
| Molecular weight | 128.02 g/mol |
| IUPAC name | 1-bromo-1,1,3,3,3-pentadeuteriopropane |
| InChIKey | CYNYIHKIEHGYOZ-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])CC([2H])([2H])Br |
Computed by PubChem (NCBI)