Products 52809-76-4
CAS 52809-76-4 is the registry number for 2-Bromopropane-1,1,1,3,3,3-d6, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 5g, 1g.
2-bromo-1,1,1,3,3,3-hexadeuteriopropane (CAS 52809-76-4) is a chemical compound with the molecular formula C3H7Br and a molecular weight of 129.03 g/mol. IUPAC name: 2-bromo-1,1,1,3,3,3-hexadeuteriopropane. InChIKey: NAMYKGVDVNBCFQ-WFGJKAKNSA-N.
| Molecular formula | C3H7Br |
|---|---|
| Molecular weight | 129.03 g/mol |
| IUPAC name | 2-bromo-1,1,1,3,3,3-hexadeuteriopropane |
| InChIKey | NAMYKGVDVNBCFQ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)
Synonyms:
2-Bromopropane-1,1,1,3,3,3-d6, 2-Bromopropane-d6, 2-bromo-1,1,1,3,3,3-hexadeuteriopropane, 2-Bromopropane-1,1,1,3,3,3-d6; 2-Bromo-1,1,1,3,3,3-hexadeuteropropane, hexadeuteroisopropyl bromide, 2-bromo(1,1,1,3,3,3-?H?)propane, 2-Bromo(1,1,1,3,3,3-~2~H_6_)propane, 2-Bromopropane-1,1,1,3,3,3-d6, 99 atom % D, 98% (CP)