Products 1219799-22-0

CAS 1219799-22-0 is the registry number for 2-Bromopropane-1,1,1,2-d4, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

2-bromo-1,1,1,2-tetradeuteriopropane (CAS 1219799-22-0) is a chemical compound with the molecular formula C3H7Br and a molecular weight of 127.02 g/mol. IUPAC name: 2-bromo-1,1,1,2-tetradeuteriopropane. InChIKey: NAMYKGVDVNBCFQ-VYMTUXDUSA-N.

Identity
Molecular formulaC3H7Br
Molecular weight127.02 g/mol
IUPAC name2-bromo-1,1,1,2-tetradeuteriopropane
InChIKeyNAMYKGVDVNBCFQ-VYMTUXDUSA-N
SMILES[2H]C([2H])([2H])C([2H])(C)Br

Computed by PubChem (NCBI)