Products 163517-62-2

CAS 163517-62-2 appears in our catalog under these names: 5–Fluoro–2–methylbenzeneboronic acid, 5-Fluoro-2-methylphenylboronic acid, 97%, 2-Methyl-5-fluorophenylboronic acid 98%, 5-Fluoro-2-methylphenylboronic acid, 98%, 5-Fluoro-2-methylphenylboronic Acid (contains varying amounts of Anhydride). Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Fluorochem, TCI. Available pack sizes: 100g, 25g, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

(5-fluoro-2-methylphenyl)boronic acid (CAS 163517-62-2) is a chemical compound with the molecular formula C7H8BFO2 and a molecular weight of 153.95 g/mol. IUPAC name: (5-fluoro-2-methylphenyl)boronic acid. InChIKey: QKOJLMKWBRBZNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BFO2
Molecular weight153.95 g/mol
IUPAC name(5-fluoro-2-methylphenyl)boronic acid
InChIKeyQKOJLMKWBRBZNQ-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)F)C)(O)O

Computed by PubChem (NCBI)