Products 301699-41-2

CAS 301699-41-2 is the registry number for (4-(Fluoromethyl)phenyl)boronic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

[4-(fluoromethyl)phenyl]boronic acid (CAS 301699-41-2) is a chemical compound with the molecular formula C7H8BFO2 and a molecular weight of 153.95 g/mol. IUPAC name: [4-(fluoromethyl)phenyl]boronic acid. InChIKey: ODFTYHQQVNHCBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BFO2
Molecular weight153.95 g/mol
IUPAC name[4-(fluoromethyl)phenyl]boronic acid
InChIKeyODFTYHQQVNHCBZ-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)CF)(O)O

Computed by PubChem (NCBI)