Products 850593-06-5

CAS 850593-06-5 appears in our catalog under these names: (3-Fluoro-5-methylphenyl)boronic acid 98%, (3-Fluoro-5-methylphenyl)boronic acid, 98%, 3–Fluoro–5–methylphenylboronic Acid (contains varying amounts of Anhydride), 3-Fluoro-5-methylphenylboronic Acid (contains varying amounts of Anhydride), (3-Fluoro-5-Methylphenyl)Boronic Acid, 98%, 98%. Offered by: Ambeed, Fluorochem, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g, 50g.

Structural formula: {0} (CAS {1})

(3-fluoro-5-methylphenyl)boronic acid (CAS 850593-06-5) is a chemical compound with the molecular formula C7H8BFO2 and a molecular weight of 153.95 g/mol. IUPAC name: (3-fluoro-5-methylphenyl)boronic acid. InChIKey: QQPLHUGOUZKARP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BFO2
Molecular weight153.95 g/mol
IUPAC name(3-fluoro-5-methylphenyl)boronic acid
InChIKeyQQPLHUGOUZKARP-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)F)C)(O)O

Computed by PubChem (NCBI)