Products 163564-55-4
CAS 163564-55-4 is the registry number for Schizostatin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]but-2-enedioic acid (CAS 163564-55-4) is a chemical compound with the molecular formula C20H30O4 and a molecular weight of 334.4 g/mol. IUPAC name: (E)-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]but-2-enedioic acid. InChIKey: XNZYMBLMYICBGE-ABTLALLYSA-N.
| Molecular formula | C20H30O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (E)-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]but-2-enedioic acid |
| InChIKey | XNZYMBLMYICBGE-ABTLALLYSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C(=C\C(=O)O)/C(=O)O)/C)/C)C |
Computed by PubChem (NCBI)
Synonyms:
schizostatin E, orb3024606