CAS 163597-57-7 appears in our catalog under these names: 3-Cyano-4-isobutoxybenzothioamide, 95%, Febuxostat Impurity 60, 3-Cyano-4-isobutyloxythiobenzamide. Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 5g, 250mg, 1g, on request.
3-cyano-4-(2-methylpropoxy)benzenecarbothioamide (CAS 163597-57-7) is a chemical compound with the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. IUPAC name: 3-cyano-4-(2-methylpropoxy)benzenecarbothioamide. InChIKey: FMHRQJJWJQGSDR-UHFFFAOYSA-N.
| Molecular formula | C12H14N2OS |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 3-cyano-4-(2-methylpropoxy)benzenecarbothioamide |
| InChIKey | FMHRQJJWJQGSDR-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=C(C=C1)C(=S)N)C#N |
Computed by PubChem (NCBI)