CAS 879053-77-7 is the registry number for 4-(4-Methoxy-2,5-dimethylphenyl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-methoxy-2,5-dimethylphenyl)-1,3-thiazol-2-amine (CAS 879053-77-7) is a chemical compound with the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. IUPAC name: 4-(4-methoxy-2,5-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: KSMXEXXVHWOJAH-UHFFFAOYSA-N.
| Molecular formula | C12H14N2OS |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 4-(4-methoxy-2,5-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | KSMXEXXVHWOJAH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)C)C2=CSC(=N2)N |
Computed by PubChem (NCBI)