CAS 443922-53-0 is the registry number for 4-(4-Ethoxy-phenyl)-5-methyl-thiazol-2-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-amine (CAS 443922-53-0) is a chemical compound with the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. IUPAC name: 4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-amine. InChIKey: WCMMJVXFGSFQLR-UHFFFAOYSA-N.
| Molecular formula | C12H14N2OS |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-amine |
| InChIKey | WCMMJVXFGSFQLR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=C(SC(=N2)N)C |
Computed by PubChem (NCBI)