CAS 16361-24-3 appears in our catalog under these names: 5-Chloro-benzo(b)thiophene-3-carboxylic acid, 5-Chloro-benzo[b]thiophene-3-carboxylic acid, 95%, 5-Chlorobenzo[b]thiophene-3-carboxylic acid, 97%(LC-MS),RG, 97%(LC-MS),RG, 5-Chloro-benzo[b]thiophene-3-carboxylic acid, 97%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 250mg, 1g, 100mg.
5-chloro-1-benzothiophene-3-carboxylic acid (CAS 16361-24-3) is a chemical compound with the molecular formula C9H5ClO2S and a molecular weight of 212.65 g/mol. IUPAC name: 5-chloro-1-benzothiophene-3-carboxylic acid. InChIKey: RTBIQTHYQWFIAO-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2S |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | 5-chloro-1-benzothiophene-3-carboxylic acid |
| InChIKey | RTBIQTHYQWFIAO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)