CAS 26018-73-5 appears in our catalog under these names: 6–Chlorobenzo(b)thiophene–2–carboxylic acid, 6-Chlorobenzo[b]thiophene-2-carboxylic acid, 96%, 96%, 6-Chlorobenzo[b]thiophene-2-carboxylic acid, 96%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
6-chloro-1-benzothiophene-2-carboxylic acid (CAS 26018-73-5) is a chemical compound with the molecular formula C9H5ClO2S and a molecular weight of 212.65 g/mol. IUPAC name: 6-chloro-1-benzothiophene-2-carboxylic acid. InChIKey: AVAGKGZNBMZOLD-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2S |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | 6-chloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | AVAGKGZNBMZOLD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)