CAS 90407-16-2 appears in our catalog under these names: 7–Chloro–1–benzothiophene–2–carboxylic acid, 7-CHLOROBENZO[B]THIOPHENE-2-CARBOXYLIC ACID, 97%,, 7-Chloro-1-benzothiophene-2-carboxylic acid, 97%, 7-Chloro-1-benzothiophene-2-carboxylic acid, 95%, 7-CHLOROBENZO[B]THIOPHENE-2-CARBOXYLIC ACID, 97%, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g, 100mg.
7-chloro-1-benzothiophene-2-carboxylic acid (CAS 90407-16-2) is a chemical compound with the molecular formula C9H5ClO2S and a molecular weight of 212.65 g/mol. IUPAC name: 7-chloro-1-benzothiophene-2-carboxylic acid. InChIKey: AAXOHLXWCUMMQS-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2S |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | 7-chloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | AAXOHLXWCUMMQS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)