Products 163618-97-1

CAS 163618-97-1 is the registry number for 2-Hydroxy-4-isopropoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-hydroxy-4-propan-2-yloxybenzoic acid (CAS 163618-97-1) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 2-hydroxy-4-propan-2-yloxybenzoic acid. InChIKey: JUIYTAQAHOONSH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O4
Molecular weight196.20 g/mol
IUPAC name2-hydroxy-4-propan-2-yloxybenzoic acid
InChIKeyJUIYTAQAHOONSH-UHFFFAOYSA-N
SMILESCC(C)OC1=CC(=C(C=C1)C(=O)O)O

Computed by PubChem (NCBI)