Products 1636881-61-2
CAS 1636881-61-2 appears in our catalog under these names: Mavoglurant racemate (AFQ–056 racemate), Mavoglurant (racemate), 98.44%, 98.44%, Mavoglurant (racemate), 98.44%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mM (in 1ml dmso), 5mg, 2 mg, 5 mg.
Methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (CAS 1636881-61-2) is a chemical compound with the molecular formula C19H23NO3 and a molecular weight of 313.4 g/mol. IUPAC name: methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate. InChIKey: ZFPZEYHRWGMJCV-ZHALLVOQSA-N.
| Molecular formula | C19H23NO3 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | methyl (3aR,4S,7aR)-4-hydroxy-4-[2-(3-methylphenyl)ethynyl]-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| InChIKey | ZFPZEYHRWGMJCV-ZHALLVOQSA-N |
| SMILES | CC1=CC(=CC=C1)C#C[C@@]2(CCC[C@@H]3[C@H]2CCN3C(=O)OC)O |
Computed by PubChem (NCBI)