Products 163719-82-2
CAS 163719-82-2 is the registry number for Ethyl 3-(4-(trifluoromethyl)phenyl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole-5-carboxylate (CAS 163719-82-2) is a chemical compound with the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. IUPAC name: ethyl 3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole-5-carboxylate. InChIKey: VDTVVMFQLPTAOT-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O3 |
|---|---|
| Molecular weight | 286.21 g/mol |
| IUPAC name | ethyl 3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | VDTVVMFQLPTAOT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)