CAS 1637453-78-1 is the registry number for (R)-4-Methyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(1R)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1637453-78-1) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1R)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: NDMCZAVGDDQQOO-HNCPQSOCSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1R)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | NDMCZAVGDDQQOO-HNCPQSOCSA-N |
| SMILES | CC1=C2CC[C@H](C2=CC=C1)N.Cl |
Computed by PubChem (NCBI)