CAS 2109874-04-4 appears in our catalog under these names: (S)-4-Methyl-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (S)–4–Methyl–2,3–dihydro–1H–inden–1–amine hydrochloride, (S)-4-Methyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97%, (S)-4-Methyl-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
(1S)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2109874-04-4) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (1S)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: NDMCZAVGDDQQOO-PPHPATTJSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (1S)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | NDMCZAVGDDQQOO-PPHPATTJSA-N |
| SMILES | CC1=C2CC[C@@H](C2=CC=C1)N.Cl |
Computed by PubChem (NCBI)