CAS 1637490-78-8 is the registry number for 5-Bromospiro[chromane-2,1'-cyclopropane], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromospiro[3,4-dihydrochromene-2,1'-cyclopropane] (CAS 1637490-78-8) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 5-bromospiro[3,4-dihydrochromene-2,1'-cyclopropane]. InChIKey: FZTONQOXEYVDNZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 5-bromospiro[3,4-dihydrochromene-2,1'-cyclopropane] |
| InChIKey | FZTONQOXEYVDNZ-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2)OC3=C1C(=CC=C3)Br |
Computed by PubChem (NCBI)