CAS 163750-77-4 appears in our catalog under these names: H-D-His(1-Me)-OH, H–D–His(1–Me)–OH, H-D-His(1-Me)-OH hydrochloride salt. Offered by: Creative Peptides, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 250mg, 1g, 5g, 500mg, 1000mg, 2000mg.
(2R)-2-amino-3-(1-methylimidazol-4-yl)propanoic acid (CAS 163750-77-4) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: (2R)-2-amino-3-(1-methylimidazol-4-yl)propanoic acid. InChIKey: BRMWTNUJHUMWMS-ZCFIWIBFSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | (2R)-2-amino-3-(1-methylimidazol-4-yl)propanoic acid |
| InChIKey | BRMWTNUJHUMWMS-ZCFIWIBFSA-N |
| SMILES | CN1C=C(N=C1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)