CAS 1638125-50-4 is the registry number for (5-(4-Fluorophenyl)oxazol-2-yl)(phenyl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-phenylmethanone (CAS 1638125-50-4) is a chemical compound with the molecular formula C16H10FNO2 and a molecular weight of 267.25 g/mol. IUPAC name: [5-(4-fluorophenyl)-1,3-oxazol-2-yl]-phenylmethanone. InChIKey: VOYOUYGUXBTFQL-UHFFFAOYSA-N.
| Molecular formula | C16H10FNO2 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]-phenylmethanone |
| InChIKey | VOYOUYGUXBTFQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC=C(O2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)