Products 441-28-1

CAS 441-28-1 is the registry number for 2-(4-Fluoro-phenyl)-quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)quinoline-4-carboxylic acid (CAS 441-28-1) is a chemical compound with the molecular formula C16H10FNO2 and a molecular weight of 267.25 g/mol. IUPAC name: 2-(4-fluorophenyl)quinoline-4-carboxylic acid. InChIKey: OSSAIQFBELCOGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H10FNO2
Molecular weight267.25 g/mol
IUPAC name2-(4-fluorophenyl)quinoline-4-carboxylic acid
InChIKeyOSSAIQFBELCOGQ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)F)C(=O)O

Computed by PubChem (NCBI)