CAS 449-81-0 is the registry number for 4-(4-Fluorobenzylidene)-2-phenyloxazol-5(4H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(4-fluorophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one (CAS 449-81-0) is a chemical compound with the molecular formula C16H10FNO2 and a molecular weight of 267.25 g/mol. IUPAC name: 4-[(4-fluorophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one. InChIKey: GGMAOSAZKMNBHB-UHFFFAOYSA-N.
| Molecular formula | C16H10FNO2 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | 4-[(4-fluorophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| InChIKey | GGMAOSAZKMNBHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC3=CC=C(C=C3)F)C(=O)O2 |
Computed by PubChem (NCBI)