CAS 1638253-66-3 is the registry number for Ethyl 7-methoxy-1h-pyrrolo[2,3-c]pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 7-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate (CAS 1638253-66-3) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: ethyl 7-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate. InChIKey: TZJLNCGHXNGBEE-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | ethyl 7-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |
| InChIKey | TZJLNCGHXNGBEE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C(=NC=C2)OC |
Computed by PubChem (NCBI)