Products 1638588-92-7
CAS 1638588-92-7 is the registry number for Mazisotine, 99.54%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg, 100 mg, 10mM/1mL.
(1S,5R)-N-[2-methyl-1-[(3-methyl-2-pyridinyl)oxy]propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide (CAS 1638588-92-7) is a chemical compound with the molecular formula C16H23N3O2 and a molecular weight of 289.37 g/mol. IUPAC name: (1S,5R)-N-[2-methyl-1-[(3-methyl-2-pyridinyl)oxy]propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide. InChIKey: PCINBSQTEDBZDB-FUNVUKJBSA-N.
| Molecular formula | C16H23N3O2 |
|---|---|
| Molecular weight | 289.37 g/mol |
| IUPAC name | (1S,5R)-N-[2-methyl-1-[(3-methyl-2-pyridinyl)oxy]propan-2-yl]-3-azabicyclo[3.1.0]hexane-6-carboxamide |
| InChIKey | PCINBSQTEDBZDB-FUNVUKJBSA-N |
| SMILES | CC1=C(N=CC=C1)OCC(C)(C)NC(=O)C2[C@H]3[C@@H]2CNC3 |
Computed by PubChem (NCBI)