CAS 1638603-93-6 is the registry number for (S)-3-(6-Chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl)propan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-[(3S)-6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]propan-1-ol (CAS 1638603-93-6) is a chemical compound with the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. IUPAC name: 3-[(3S)-6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]propan-1-ol. InChIKey: YJXUQTADKAYUEA-ZETCQYMHSA-N.
| Molecular formula | C10H14ClN3O |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 3-[(3S)-6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazin-3-yl]propan-1-ol |
| InChIKey | YJXUQTADKAYUEA-ZETCQYMHSA-N |
| SMILES | C1[C@@H](NC2=C(N1)C=CC(=N2)Cl)CCCO |
Computed by PubChem (NCBI)