Products 2570189-93-2
CAS 2570189-93-2 appears in our catalog under these names: 6-Amino-3-ethyl-1,2-dihydroquinazolin-4-one hydrochloride, 95%, 6-Amino-3-ethyl-2,3-dihydroquinazolin-4(1H)-one hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6-amino-3-ethyl-1,2-dihydroquinazolin-4-one;hydrochloride (CAS 2570189-93-2) is a chemical compound with the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. IUPAC name: 6-amino-3-ethyl-1,2-dihydroquinazolin-4-one;hydrochloride. InChIKey: XZCHTZZJXIRWOO-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 6-amino-3-ethyl-1,2-dihydroquinazolin-4-one;hydrochloride |
| InChIKey | XZCHTZZJXIRWOO-UHFFFAOYSA-N |
| SMILES | CCN1CNC2=C(C1=O)C=C(C=C2)N.Cl |
Computed by PubChem (NCBI)