CAS 2089257-32-7 appears in our catalog under these names: 5-Amino-1,3,6-trimethyl-1,3-dihydro-2h-benzimidazol-2-one hydrochloride, 95%, 5-Amino-1,3,6-trimethyl-1H-benzo(d)imidazol-2(3H)-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 250mg, 5g.
5-amino-1,3,6-trimethylbenzimidazol-2-one;hydrochloride (CAS 2089257-32-7) is a chemical compound with the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. IUPAC name: 5-amino-1,3,6-trimethylbenzimidazol-2-one;hydrochloride. InChIKey: HSVHUZSEOXFQSG-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 5-amino-1,3,6-trimethylbenzimidazol-2-one;hydrochloride |
| InChIKey | HSVHUZSEOXFQSG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1N)N(C(=O)N2C)C.Cl |
Computed by PubChem (NCBI)