Products 1638761-41-7

CAS 1638761-41-7 is the registry number for 1-Boc-7-cbz-1,7-diaza-spiro[4.5]decane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

9-O-benzyl 1-O-tert-butyl 1,9-diazaspiro[4.5]decane-1,9-dicarboxylate (CAS 1638761-41-7) is a chemical compound with the molecular formula C21H30N2O4 and a molecular weight of 374.5 g/mol. IUPAC name: 9-O-benzyl 1-O-tert-butyl 1,9-diazaspiro[4.5]decane-1,9-dicarboxylate. InChIKey: QOESRCAGXQLJJM-UHFFFAOYSA-N.

Identity
Molecular formulaC21H30N2O4
Molecular weight374.5 g/mol
IUPAC name9-O-benzyl 1-O-tert-butyl 1,9-diazaspiro[4.5]decane-1,9-dicarboxylate
InChIKeyQOESRCAGXQLJJM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC12CCCN(C2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)