Products 929301-98-4

CAS 929301-98-4 is the registry number for 8-Benzyl 2-(tert-butyl) 2,8-diazaspiro[4.5]decane-2,8-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-O-benzyl 2-O-tert-butyl 2,8-diazaspiro[4.5]decane-2,8-dicarboxylate (CAS 929301-98-4) is a chemical compound with the molecular formula C21H30N2O4 and a molecular weight of 374.5 g/mol. IUPAC name: 8-O-benzyl 2-O-tert-butyl 2,8-diazaspiro[4.5]decane-2,8-dicarboxylate. InChIKey: GLTBYYZYOMQYEL-UHFFFAOYSA-N.

Identity
Molecular formulaC21H30N2O4
Molecular weight374.5 g/mol
IUPAC name8-O-benzyl 2-O-tert-butyl 2,8-diazaspiro[4.5]decane-2,8-dicarboxylate
InChIKeyGLTBYYZYOMQYEL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CCN(CC2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)