CAS 1823261-82-0 appears in our catalog under these names: 2-tert-Butyl 8-ethyl 6-benzyl-2,6-diazaspiro[3.4]octane-2,8-dicarboxylate, 95%, 2-tert-Butyl 8-ethyl 6-benzyl-2,6-diazaspiro(3.4)octane-2,8-dicarboxylate, 98%, 2–tert–butyl 8–ethyl 6–benzyl–2,6–diazaspiro(3·4)octane–2,8–dicarboxylate, 2-tert-Butyl 8-ethyl 6-benzyl-2,6-diazaspiro[3.4]octane-2,8-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-O-tert-butyl 5-O-ethyl 7-benzyl-2,7-diazaspiro[3.4]octane-2,5-dicarboxylate (CAS 1823261-82-0) is a chemical compound with the molecular formula C21H30N2O4 and a molecular weight of 374.5 g/mol. IUPAC name: 2-O-tert-butyl 5-O-ethyl 7-benzyl-2,7-diazaspiro[3.4]octane-2,5-dicarboxylate. InChIKey: SRUDCLUSLCNCPB-UHFFFAOYSA-N.
| Molecular formula | C21H30N2O4 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-ethyl 7-benzyl-2,7-diazaspiro[3.4]octane-2,5-dicarboxylate |
| InChIKey | SRUDCLUSLCNCPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CC12CN(C2)C(=O)OC(C)(C)C)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)