CAS 1638765-12-4 appears in our catalog under these names: Rel-(3r,4s)-4-fluoropiperidin-3-ol hydrochloride, 95%, rel-(3R,4S)-4-Fluoropiperidin-3-ol hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
(3S,4R)-4-fluoropiperidin-3-ol;hydrochloride (CAS 1638765-12-4) is a chemical compound with the molecular formula C5H11ClFNO and a molecular weight of 155.60 g/mol. IUPAC name: (3S,4R)-4-fluoropiperidin-3-ol;hydrochloride. InChIKey: CGOYYYHEMMLYLM-JBUOLDKXSA-N.
| Molecular formula | C5H11ClFNO |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | (3S,4R)-4-fluoropiperidin-3-ol;hydrochloride |
| InChIKey | CGOYYYHEMMLYLM-JBUOLDKXSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1F)O.Cl |
Computed by PubChem (NCBI)