Products 1638920-43-0

CAS 1638920-43-0 is the registry number for 3-(Trifluoromethoxy)azetidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(trifluoromethoxy)azetidine-3-carboxylic acid (CAS 1638920-43-0) is a chemical compound with the molecular formula C5H6F3NO3 and a molecular weight of 185.10 g/mol. IUPAC name: 3-(trifluoromethoxy)azetidine-3-carboxylic acid. InChIKey: CBEPYFHNVGMAQX-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6F3NO3
Molecular weight185.10 g/mol
IUPAC name3-(trifluoromethoxy)azetidine-3-carboxylic acid
InChIKeyCBEPYFHNVGMAQX-UHFFFAOYSA-N
SMILESC1C(CN1)(C(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)