CAS 2089255-86-5 appears in our catalog under these names: Azetidin-3-one trifluoroacetic acid, 95%, Azetidin-3-one trifluoroacetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Azetidin-3-one;2,2,2-trifluoroacetic acid (CAS 2089255-86-5) is a chemical compound with the molecular formula C5H6F3NO3 and a molecular weight of 185.10 g/mol. IUPAC name: azetidin-3-one;2,2,2-trifluoroacetic acid. InChIKey: ITLJQGKTDSBQBF-UHFFFAOYSA-N.
| Molecular formula | C5H6F3NO3 |
|---|---|
| Molecular weight | 185.10 g/mol |
| IUPAC name | azetidin-3-one;2,2,2-trifluoroacetic acid |
| InChIKey | ITLJQGKTDSBQBF-UHFFFAOYSA-N |
| SMILES | C1C(=O)CN1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)