Products 2089255-86-5

CAS 2089255-86-5 appears in our catalog under these names: Azetidin-3-one trifluoroacetic acid, 95%, Azetidin-3-one trifluoroacetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Azetidin-3-one;2,2,2-trifluoroacetic acid (CAS 2089255-86-5) is a chemical compound with the molecular formula C5H6F3NO3 and a molecular weight of 185.10 g/mol. IUPAC name: azetidin-3-one;2,2,2-trifluoroacetic acid. InChIKey: ITLJQGKTDSBQBF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6F3NO3
Molecular weight185.10 g/mol
IUPAC nameazetidin-3-one;2,2,2-trifluoroacetic acid
InChIKeyITLJQGKTDSBQBF-UHFFFAOYSA-N
SMILESC1C(=O)CN1.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)