CAS 7592-26-9 appears in our catalog under these names: (2,2,2–Trifluoroacetyl)–D–alanine, (2,2,2-Trifluoroacetyl)-D-alanine, (2,2,2-Trifluoroacetyl)-d-alanine, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg.
(2R)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid (CAS 7592-26-9) is a chemical compound with the molecular formula C5H6F3NO3 and a molecular weight of 185.10 g/mol. IUPAC name: (2R)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid. InChIKey: WLVJROFMCNWTBX-UWTATZPHSA-N.
| Molecular formula | C5H6F3NO3 |
|---|---|
| Molecular weight | 185.10 g/mol |
| IUPAC name | (2R)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| InChIKey | WLVJROFMCNWTBX-UWTATZPHSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)