Products 163918-99-8
CAS 163918-99-8 is the registry number for 4-(2-Oxo-1,3-diazinan-1-yl)benzonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(2-oxo-1,3-diazinan-1-yl)benzonitrile (CAS 163918-99-8) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 4-(2-oxo-1,3-diazinan-1-yl)benzonitrile. InChIKey: KOHLNECAEDCZHU-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 4-(2-oxo-1,3-diazinan-1-yl)benzonitrile |
| InChIKey | KOHLNECAEDCZHU-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)