Products 1639265-45-4

CAS 1639265-45-4 is the registry number for Silodosin Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[5-[(2R)-2-aminopropyl]-7-cyanoindol-1-yl]propyl benzoate (CAS 1639265-45-4) is a chemical compound with the molecular formula C22H23N3O2 and a molecular weight of 361.4 g/mol. IUPAC name: 3-[5-[(2R)-2-aminopropyl]-7-cyanoindol-1-yl]propyl benzoate. InChIKey: FKRKZGCKZMADTC-MRXNPFEDSA-N.

Identity
Molecular formulaC22H23N3O2
Molecular weight361.4 g/mol
IUPAC name3-[5-[(2R)-2-aminopropyl]-7-cyanoindol-1-yl]propyl benzoate
InChIKeyFKRKZGCKZMADTC-MRXNPFEDSA-N
SMILESC[C@H](CC1=CC(=C2C(=C1)C=CN2CCCOC(=O)C3=CC=CC=C3)C#N)N

Computed by PubChem (NCBI)