CAS 55902-02-8 is the registry number for Isamfazone. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
N-methyl-2-(6-oxo-3-phenylpyridazin-1-yl)-N-(1-phenylpropan-2-yl)acetamide (CAS 55902-02-8) is a chemical compound with the molecular formula C22H23N3O2 and a molecular weight of 361.4 g/mol. IUPAC name: N-methyl-2-(6-oxo-3-phenylpyridazin-1-yl)-N-(1-phenylpropan-2-yl)acetamide. InChIKey: JKNDAGNFBPJGEF-UHFFFAOYSA-N.
| Molecular formula | C22H23N3O2 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | N-methyl-2-(6-oxo-3-phenylpyridazin-1-yl)-N-(1-phenylpropan-2-yl)acetamide |
| InChIKey | JKNDAGNFBPJGEF-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=CC=C1)N(C)C(=O)CN2C(=O)C=CC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)