Products 639489-84-2
CAS 639489-84-2 appears in our catalog under these names: Bradanicline, Bradanicline, 99%, 99%, Bradanicline, 98.51%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 10mM/1mL, 50 mg, 5 mg, 25 mg.
N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzofuran-2-carboxamide (CAS 639489-84-2) is a chemical compound with the molecular formula C22H23N3O2 and a molecular weight of 361.4 g/mol. IUPAC name: N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzofuran-2-carboxamide. InChIKey: OXKRFEWMSWPKKV-GHTZIAJQSA-N.
| Molecular formula | C22H23N3O2 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzofuran-2-carboxamide |
| InChIKey | OXKRFEWMSWPKKV-GHTZIAJQSA-N |
| SMILES | C1CN2CCC1[C@H]([C@@H]2CC3=CN=CC=C3)NC(=O)C4=CC5=CC=CC=C5O4 |
Computed by PubChem (NCBI)